PNG  IHDRQgAMA a cHRMz&u0`:pQ<bKGDgmIDATxwUﹻ& ^CX(J I@ "% (** BX +*i"]j(IH{~R)[~>h{}gy)I$Ij .I$I$ʊy@}x.: $I$Ii}VZPC)I$IF ^0ʐJ$I$Q^}{"r=OzI$gRZeC.IOvH eKX $IMpxsk.쒷/&r[޳<v| .I~)@$updYRa$I |M.e JaֶpSYR6j>h%IRز if&uJ)M$I vLi=H;7UJ,],X$I1AҒJ$ XY XzI@GNҥRT)E@;]K*Mw;#5_wOn~\ DC&$(A5 RRFkvIR}l!RytRl;~^ǷJj اy뷦BZJr&ӥ8Pjw~vnv X^(I;4R=P[3]J,]ȏ~:3?[ a&e)`e*P[4]T=Cq6R[ ~ޤrXR Հg(t_HZ-Hg M$ãmL5R uk*`%C-E6/%[t X.{8P9Z.vkXŐKjgKZHg(aK9ڦmKjѺm_ \#$5,)-  61eJ,5m| r'= &ڡd%-]J on Xm|{ RҞe $eڧY XYrԮ-a7RK6h>n$5AVڴi*ֆK)mѦtmr1p| q:흺,)Oi*ֺK)ܬ֦K-5r3>0ԔHjJئEZj,%re~/z%jVMڸmrt)3]J,T K֦OvԒgii*bKiNO~%PW0=dii2tJ9Jݕ{7"I P9JKTbu,%r"6RKU}Ij2HKZXJ,妝 XYrP ެ24c%i^IK|.H,%rb:XRl1X4Pe/`x&P8Pj28Mzsx2r\zRPz4J}yP[g=L) .Q[6RjWgp FIH*-`IMRaK9TXcq*I y[jE>cw%gLRԕiFCj-ďa`#e~I j,%r,)?[gp FI˨mnWX#>mʔ XA DZf9,nKҲzIZXJ,L#kiPz4JZF,I,`61%2s $,VOϚ2/UFJfy7K> X+6 STXIeJILzMfKm LRaK9%|4p9LwJI!`NsiazĔ)%- XMq>pk$-$Q2x#N ؎-QR}ᶦHZډ)J,l#i@yn3LN`;nڔ XuX5pF)m|^0(>BHF9(cզEerJI rg7 4I@z0\JIi䵙RR0s;$s6eJ,`n 䂦0a)S)A 1eJ,堌#635RIgpNHuTH_SԕqVe ` &S)>p;S$魁eKIuX`I4춒o}`m$1":PI<[v9^\pTJjriRŭ P{#{R2,`)e-`mgj~1ϣLKam7&U\j/3mJ,`F;M'䱀 .KR#)yhTq;pcK9(q!w?uRR,n.yw*UXj#\]ɱ(qv2=RqfB#iJmmL<]Y͙#$5 uTU7ӦXR+q,`I}qL'`6Kͷ6r,]0S$- [RKR3oiRE|nӦXR.(i:LDLTJjY%o:)6rxzҒqTJjh㞦I.$YR.ʼnGZ\ֿf:%55 I˼!6dKxm4E"mG_ s? .e*?LRfK9%q#uh$)i3ULRfK9yxm܌bj84$i1U^@Wbm4uJ,ҪA>_Ij?1v32[gLRD96oTaR׿N7%L2 NT,`)7&ƝL*꽙yp_$M2#AS,`)7$rkTA29_Iye"|/0t)$n XT2`YJ;6Jx".e<`$) PI$5V4]29SRI>~=@j]lp2`K9Jaai^" Ԋ29ORI%:XV5]JmN9]H;1UC39NI%Xe78t)a;Oi Ҙ>Xt"~G>_mn:%|~ޅ_+]$o)@ǀ{hgN;IK6G&rp)T2i୦KJuv*T=TOSV>(~D>dm,I*Ɛ:R#ۙNI%D>G.n$o;+#RR!.eU˽TRI28t)1LWϚ>IJa3oFbu&:tJ*(F7y0ZR ^p'Ii L24x| XRI%ۄ>S1]Jy[zL$adB7.eh4%%누>WETf+3IR:I3Xה)3אOۦSRO'ٺ)S}"qOr[B7ϙ.edG)^ETR"RtRݜh0}LFVӦDB^k_JDj\=LS(Iv─aTeZ%eUAM-0;~˃@i|l @S4y72>sX-vA}ϛBI!ݎߨWl*)3{'Y|iSlEڻ(5KtSI$Uv02,~ԩ~x;P4ցCrO%tyn425:KMlD ^4JRxSهF_}شJTS6uj+ﷸk$eZO%G*^V2u3EMj3k%)okI]dT)URKDS 7~m@TJR~荪fT"֛L \sM -0T KfJz+nإKr L&j()[E&I ߴ>e FW_kJR|!O:5/2跌3T-'|zX ryp0JS ~^F>-2< `*%ZFP)bSn"L :)+pʷf(pO3TMW$~>@~ū:TAIsV1}S2<%ޟM?@iT ,Eūoz%i~g|`wS(]oȤ8)$ ntu`өe`6yPl IzMI{ʣzʨ )IZ2= ld:5+請M$-ї;U>_gsY$ÁN5WzWfIZ)-yuXIfp~S*IZdt;t>KūKR|$#LcԀ+2\;kJ`]YǔM1B)UbG"IRߊ<xܾӔJ0Z='Y嵤 Leveg)$znV-º^3Ւof#0Tfk^Zs[*I꯳3{)ˬW4Ւ4 OdpbZRS|*I 55#"&-IvT&/윚Ye:i$ 9{LkuRe[I~_\ؠ%>GL$iY8 9ܕ"S`kS.IlC;Ҏ4x&>u_0JLr<J2(^$5L s=MgV ~,Iju> 7r2)^=G$1:3G< `J3~&IR% 6Tx/rIj3O< ʔ&#f_yXJiގNSz; Tx(i8%#4 ~AS+IjerIUrIj362v885+IjAhK__5X%nV%Iͳ-y|7XV2v4fzo_68"S/I-qbf; LkF)KSM$ Ms>K WNV}^`-큧32ŒVؙGdu,^^m%6~Nn&͓3ŒVZMsRpfEW%IwdǀLm[7W&bIRL@Q|)* i ImsIMmKmyV`i$G+R 0tV'!V)֏28vU7͒vHꦼtxꗞT ;S}7Mf+fIRHNZUkUx5SAJㄌ9MqμAIRi|j5)o*^'<$TwI1hEU^c_j?Е$%d`z cyf,XO IJnTgA UXRD }{H}^S,P5V2\Xx`pZ|Yk:$e ~ @nWL.j+ϝYb퇪bZ BVu)u/IJ_ 1[p.p60bC >|X91P:N\!5qUB}5a5ja `ubcVxYt1N0Zzl4]7­gKj]?4ϻ *[bg$)+À*x쳀ogO$~,5 زUS9 lq3+5mgw@np1sso Ӻ=|N6 /g(Wv7U;zωM=wk,0uTg_`_P`uz?2yI!b`kĸSo+Qx%!\οe|އԁKS-s6pu_(ֿ$i++T8=eY; צP+phxWQv*|p1. ά. XRkIQYP,drZ | B%wP|S5`~́@i޾ E;Չaw{o'Q?%iL{u D?N1BD!owPHReFZ* k_-~{E9b-~P`fE{AܶBJAFO wx6Rox5 K5=WwehS8 (JClJ~ p+Fi;ŗo+:bD#g(C"wA^ r.F8L;dzdIHUX݆ϞXg )IFqem%I4dj&ppT{'{HOx( Rk6^C٫O.)3:s(۳(Z?~ٻ89zmT"PLtw䥈5&b<8GZ-Y&K?e8,`I6e(֍xb83 `rzXj)F=l($Ij 2*(F?h(/9ik:I`m#p3MgLaKjc/U#n5S# m(^)=y=đx8ŬI[U]~SцA4p$-F i(R,7Cx;X=cI>{Km\ o(Tv2vx2qiiDJN,Ҏ!1f 5quBj1!8 rDFd(!WQl,gSkL1Bxg''՞^ǘ;pQ P(c_ IRujg(Wz bs#P­rz> k c&nB=q+ؔXn#r5)co*Ũ+G?7< |PQӣ'G`uOd>%Mctz# Ԫڞ&7CaQ~N'-P.W`Oedp03C!IZcIAMPUۀ5J<\u~+{9(FbbyAeBhOSܳ1 bÈT#ŠyDžs,`5}DC-`̞%r&ڙa87QWWp6e7 Rϫ/oY ꇅ Nܶըtc!LA T7V4Jsū I-0Pxz7QNF_iZgúWkG83 0eWr9 X]㾮݁#Jˢ C}0=3ݱtBi]_ &{{[/o[~ \q鯜00٩|cD3=4B_b RYb$óBRsf&lLX#M*C_L܄:gx)WΘsGSbuL rF$9';\4Ɍq'n[%p.Q`u hNb`eCQyQ|l_C>Lb꟟3hSb #xNxSs^ 88|Mz)}:](vbۢamŖ࿥ 0)Q7@0=?^k(*J}3ibkFn HjB׻NO z x}7p 0tfDX.lwgȔhԾŲ }6g E |LkLZteu+=q\Iv0쮑)QٵpH8/2?Σo>Jvppho~f>%bMM}\//":PTc(v9v!gոQ )UfVG+! 35{=x\2+ki,y$~A1iC6#)vC5^>+gǵ@1Hy٪7u;p psϰu/S <aʸGu'tD1ԝI<pg|6j'p:tպhX{o(7v],*}6a_ wXRk,O]Lܳ~Vo45rp"N5k;m{rZbΦ${#)`(Ŵg,;j%6j.pyYT?}-kBDc3qA`NWQū20/^AZW%NQ MI.X#P#,^Ebc&?XR tAV|Y.1!؅⨉ccww>ivl(JT~ u`ٵDm q)+Ri x/x8cyFO!/*!/&,7<.N,YDŽ&ܑQF1Bz)FPʛ?5d 6`kQձ λc؎%582Y&nD_$Je4>a?! ͨ|ȎWZSsv8 j(I&yj Jb5m?HWp=g}G3#|I,5v珿] H~R3@B[☉9Ox~oMy=J;xUVoj bUsl_35t-(ՃɼRB7U!qc+x4H_Qo֮$[GO<4`&č\GOc[.[*Af%mG/ ňM/r W/Nw~B1U3J?P&Y )`ѓZ1p]^l“W#)lWZilUQu`-m|xĐ,_ƪ|9i:_{*(3Gѧ}UoD+>m_?VPۅ15&}2|/pIOʵ> GZ9cmíتmnz)yߐbD >e}:) r|@R5qVSA10C%E_'^8cR7O;6[eKePGϦX7jb}OTGO^jn*媓7nGMC t,k31Rb (vyܴʭ!iTh8~ZYZp(qsRL ?b}cŨʊGO^!rPJO15MJ[c&~Z`"ѓޔH1C&^|Ш|rʼ,AwĴ?b5)tLU)F| &g٣O]oqSUjy(x<Ϳ3 .FSkoYg2 \_#wj{u'rQ>o;%n|F*O_L"e9umDds?.fuuQbIWz |4\0 sb;OvxOSs; G%T4gFRurj(֍ڑb uԖKDu1MK{1^ q; C=6\8FR艇!%\YÔU| 88m)֓NcLve C6z;o&X x59:q61Z(T7>C?gcļxѐ Z oo-08jہ x,`' ҔOcRlf~`jj".Nv+sM_]Zk g( UOPyεx%pUh2(@il0ݽQXxppx-NS( WO+轾 nFߢ3M<;z)FBZjciu/QoF 7R¥ ZFLF~#ȣߨ^<쩡ݛкvџ))ME>ώx4m#!-m!L;vv#~Y[đKmx9.[,UFS CVkZ +ߟrY٧IZd/ioi$%͝ب_ֶX3ܫhNU ZZgk=]=bbJS[wjU()*I =ώ:}-蹞lUj:1}MWm=̛ _ ¾,8{__m{_PVK^n3esw5ӫh#$-q=A̟> ,^I}P^J$qY~Q[ Xq9{#&T.^GVj__RKpn,b=`żY@^՝;z{paVKkQXj/)y TIc&F;FBG7wg ZZDG!x r_tƢ!}i/V=M/#nB8 XxЫ ^@CR<{䤭YCN)eKOSƟa $&g[i3.C6xrOc8TI;o hH6P&L{@q6[ Gzp^71j(l`J}]e6X☉#͕ ׈$AB1Vjh㭦IRsqFBjwQ_7Xk>y"N=MB0 ,C #o6MRc0|$)ف"1!ixY<B9mx `,tA>)5ػQ?jQ?cn>YZe Tisvh# GMމȇp:ԴVuږ8ɼH]C.5C!UV;F`mbBk LTMvPʍϤj?ԯ/Qr1NB`9s"s TYsz &9S%U԰> {<ؿSMxB|H\3@!U| k']$U+> |HHMLޢ?V9iD!-@x TIî%6Z*9X@HMW#?nN ,oe6?tQwڱ.]-y':mW0#!J82qFjH -`ѓ&M0u Uγmxϵ^-_\])@0Rt.8/?ٰCY]x}=sD3ojަЫNuS%U}ԤwHH>ڗjܷ_3gN q7[q2la*ArǓԖ+p8/RGM ]jacd(JhWko6ڎbj]i5Bj3+3!\j1UZLsLTv8HHmup<>gKMJj0@H%,W΃7R) ">c, xixј^ aܖ>H[i.UIHc U1=yW\=S*GR~)AF=`&2h`DzT󑓶J+?W+}C%P:|0H܆}-<;OC[~o.$~i}~HQ TvXΈr=b}$vizL4:ȰT|4~*!oXQR6Lk+#t/g lԁߖ[Jڶ_N$k*". xsxX7jRVbAAʯKҎU3)zSNN _'s?f)6X!%ssAkʱ>qƷb hg %n ~p1REGMHH=BJiy[<5 ǁJҖgKR*倳e~HUy)Ag,K)`Vw6bRR:qL#\rclK/$sh*$ 6덤 KԖc 3Z9=Ɣ=o>X Ώ"1 )a`SJJ6k(<c e{%kϊP+SL'TcMJWRm ŏ"w)qc ef꒵i?b7b('"2r%~HUS1\<(`1Wx9=8HY9m:X18bgD1u ~|H;K-Uep,, C1 RV.MR5άh,tWO8WC$ XRVsQS]3GJ|12 [vM :k#~tH30Rf-HYݺ-`I9%lIDTm\ S{]9gOڒMNCV\G*2JRŨ;Rҏ^ڽ̱mq1Eu?To3I)y^#jJw^Ńj^vvlB_⋌P4x>0$c>K†Aļ9s_VjTt0l#m>E-,,x,-W)سo&96RE XR.6bXw+)GAEvL)͞K4$p=Ũi_ѱOjb HY/+@θH9޼]Nԥ%n{ &zjT? Ty) s^ULlb,PiTf^<À] 62R^V7)S!nllS6~͝V}-=%* ʻ>G DnK<y&>LPy7'r=Hj 9V`[c"*^8HpcO8bnU`4JȪAƋ#1_\ XϘHPRgik(~G~0DAA_2p|J묭a2\NCr]M_0 ^T%e#vD^%xy-n}-E\3aS%yN!r_{ )sAw ڼp1pEAk~v<:`'ӭ^5 ArXOI驻T (dk)_\ PuA*BY]yB"l\ey hH*tbK)3 IKZ򹞋XjN n *n>k]X_d!ryBH ]*R 0(#'7 %es9??ښFC,ՁQPjARJ\Ρw K#jahgw;2$l*) %Xq5!U᢯6Re] |0[__64ch&_}iL8KEgҎ7 M/\`|.p,~`a=BR?xܐrQ8K XR2M8f ?`sgWS%" Ԉ 7R%$ N}?QL1|-эټwIZ%pvL3Hk>,ImgW7{E xPHx73RA @RS CC !\ȟ5IXR^ZxHл$Q[ŝ40 (>+ _C >BRt<,TrT {O/H+˟Pl6 I B)/VC<6a2~(XwV4gnXR ϱ5ǀHٻ?tw똤Eyxp{#WK qG%5],(0ӈH HZ])ג=K1j&G(FbM@)%I` XRg ʔ KZG(vP,<`[ Kn^ SJRsAʠ5xՅF`0&RbV tx:EaUE/{fi2;.IAwW8/tTxAGOoN?G}l L(n`Zv?pB8K_gI+ܗ #i?ޙ.) p$utc ~DžfՈEo3l/)I-U?aԅ^jxArA ΧX}DmZ@QLےbTXGd.^|xKHR{|ΕW_h] IJ`[G9{).y) 0X YA1]qp?p_k+J*Y@HI>^?gt.06Rn ,` ?);p pSF9ZXLBJPWjgQ|&)7! HjQt<| ؅W5 x W HIzYoVMGP Hjn`+\(dNW)F+IrS[|/a`K|ͻ0Hj{R,Q=\ (F}\WR)AgSG`IsnAR=|8$}G(vC$)s FBJ?]_u XRvύ6z ŨG[36-T9HzpW̞ú Xg큽=7CufzI$)ki^qk-) 0H*N` QZkk]/tnnsI^Gu't=7$ Z;{8^jB% IItRQS7[ϭ3 $_OQJ`7!]W"W,)Iy W AJA;KWG`IY{8k$I$^%9.^(`N|LJ%@$I}ֽp=FB*xN=gI?Q{٥4B)mw $Igc~dZ@G9K X?7)aK%݅K$IZ-`IpC U6$I\0>!9k} Xa IIS0H$I H ?1R.Чj:4~Rw@p$IrA*u}WjWFPJ$I➓/6#! LӾ+ X36x8J |+L;v$Io4301R20M I$-E}@,pS^ޟR[/s¹'0H$IKyfŸfVOπFT*a$I>He~VY/3R/)>d$I>28`Cjw,n@FU*9ttf$I~<;=/4RD~@ X-ѕzἱI$: ԍR a@b X{+Qxuq$IЛzo /~3\8ڒ4BN7$IҀj V]n18H$IYFBj3̵̚ja pp $Is/3R Ӻ-Yj+L;.0ŔI$Av? #!5"aʄj}UKmɽH$IjCYs?h$IDl843.v}m7UiI=&=0Lg0$I4: embe` eQbm0u? $IT!Sƍ'-sv)s#C0:XB2a w I$zbww{."pPzO =Ɔ\[ o($Iaw]`E).Kvi:L*#gР7[$IyGPI=@R 4yR~̮´cg I$I/<tPͽ hDgo 94Z^k盇΄8I56^W$I^0̜N?4*H`237}g+hxoq)SJ@p|` $I%>-hO0eO>\ԣNߌZD6R=K ~n($I$y3D>o4b#px2$yڪtzW~a $I~?x'BwwpH$IZݑnC㧄Pc_9sO gwJ=l1:mKB>Ab<4Lp$Ib o1ZQ@85b̍ S'F,Fe,^I$IjEdù{l4 8Ys_s Z8.x m"+{~?q,Z D!I$ϻ'|XhB)=…']M>5 rgotԎ 獽PH$IjIPhh)n#cÔqA'ug5qwU&rF|1E%I$%]!'3AFD/;Ck_`9 v!ٴtPV;x`'*bQa w I$Ix5 FC3D_~A_#O݆DvV?<qw+I$I{=Z8".#RIYyjǪ=fDl9%M,a8$I$Ywi[7ݍFe$s1ՋBVA?`]#!oz4zjLJo8$I$%@3jAa4(o ;p,,dya=F9ً[LSPH$IJYЉ+3> 5"39aZ<ñh!{TpBGkj}Sp $IlvF.F$I z< '\K*qq.f<2Y!S"-\I$IYwčjF$ w9 \ߪB.1v!Ʊ?+r:^!I$BϹB H"B;L'G[ 4U#5>੐)|#o0aڱ$I>}k&1`U#V?YsV x>{t1[I~D&(I$I/{H0fw"q"y%4 IXyE~M3 8XψL}qE$I[> nD?~sf ]o΁ cT6"?'_Ἣ $I>~.f|'!N?⟩0G KkXZE]ޡ;/&?k OۘH$IRۀwXӨ<7@PnS04aӶp.:@\IWQJ6sS%I$e5ڑv`3:x';wq_vpgHyXZ 3gЂ7{{EuԹn±}$I$8t;b|591nءQ"P6O5i }iR̈́%Q̄p!I䮢]O{H$IRϻ9s֧ a=`- aB\X0"+5"C1Hb?߮3x3&gşggl_hZ^,`5?ߎvĸ%̀M!OZC2#0x LJ0 Gw$I$I}<{Eb+y;iI,`ܚF:5ܛA8-O-|8K7s|#Z8a&><a&/VtbtLʌI$I$I$I$I$I$IRjDD%tEXtdate:create2022-05-31T04:40:26+00:00!Î%tEXtdate:modify2022-05-31T04:40:26+00:00|{2IENDB` sh-3ll

HOME


sh-3ll 1.0
DIR:/opt/cpanel/ea-wappspector/vendor/squizlabs/php_codesniffer/src/
Upload File :
Current File : //opt/cpanel/ea-wappspector/vendor/squizlabs/php_codesniffer/src/Runner.php
<?php
/**
 * Responsible for running PHPCS and PHPCBF.
 *
 * After creating an object of this class, you probably just want to
 * call runPHPCS() or runPHPCBF().
 *
 * @author    Greg Sherwood <gsherwood@squiz.net>
 * @copyright 2006-2015 Squiz Pty Ltd (ABN 77 084 670 600)
 * @license   https://github.com/PHPCSStandards/PHP_CodeSniffer/blob/master/licence.txt BSD Licence
 */

namespace PHP_CodeSniffer;

use Exception;
use InvalidArgumentException;
use PHP_CodeSniffer\Exceptions\DeepExitException;
use PHP_CodeSniffer\Exceptions\RuntimeException;
use PHP_CodeSniffer\Files\DummyFile;
use PHP_CodeSniffer\Files\File;
use PHP_CodeSniffer\Files\FileList;
use PHP_CodeSniffer\Util\Cache;
use PHP_CodeSniffer\Util\Common;
use PHP_CodeSniffer\Util\Standards;
use PHP_CodeSniffer\Util\Timing;
use PHP_CodeSniffer\Util\Tokens;

class Runner
{

    /**
     * The config data for the run.
     *
     * @var \PHP_CodeSniffer\Config
     */
    public $config = null;

    /**
     * The ruleset used for the run.
     *
     * @var \PHP_CodeSniffer\Ruleset
     */
    public $ruleset = null;

    /**
     * The reporter used for generating reports after the run.
     *
     * @var \PHP_CodeSniffer\Reporter
     */
    public $reporter = null;


    /**
     * Run the PHPCS script.
     *
     * @return int
     */
    public function runPHPCS()
    {
        $this->registerOutOfMemoryShutdownMessage('phpcs');

        try {
            Timing::startTiming();
            Runner::checkRequirements();

            if (defined('PHP_CODESNIFFER_CBF') === false) {
                define('PHP_CODESNIFFER_CBF', false);
            }

            // Creating the Config object populates it with all required settings
            // based on the CLI arguments provided to the script and any config
            // values the user has set.
            $this->config = new Config();

            // Init the run and load the rulesets to set additional config vars.
            $this->init();

            // Print a list of sniffs in each of the supplied standards.
            // We fudge the config here so that each standard is explained in isolation.
            if ($this->config->explain === true) {
                $standards = $this->config->standards;
                foreach ($standards as $standard) {
                    $this->config->standards = [$standard];
                    $ruleset = new Ruleset($this->config);
                    $ruleset->explain();
                }

                return 0;
            }

            // Generate documentation for each of the supplied standards.
            if ($this->config->generator !== null) {
                $standards = $this->config->standards;
                foreach ($standards as $standard) {
                    $this->config->standards = [$standard];
                    $ruleset   = new Ruleset($this->config);
                    $class     = 'PHP_CodeSniffer\Generators\\'.$this->config->generator;
                    $generator = new $class($ruleset);
                    $generator->generate();
                }

                return 0;
            }

            // Other report formats don't really make sense in interactive mode
            // so we hard-code the full report here and when outputting.
            // We also ensure parallel processing is off because we need to do one file at a time.
            if ($this->config->interactive === true) {
                $this->config->reports      = ['full' => null];
                $this->config->parallel     = 1;
                $this->config->showProgress = false;
            }

            // Disable caching if we are processing STDIN as we can't be 100%
            // sure where the file came from or if it will change in the future.
            if ($this->config->stdin === true) {
                $this->config->cache = false;
            }

            $numErrors = $this->run();

            // Print all the reports for this run.
            $toScreen = $this->reporter->printReports();

            // Only print timer output if no reports were
            // printed to the screen so we don't put additional output
            // in something like an XML report. If we are printing to screen,
            // the report types would have already worked out who should
            // print the timer info.
            if ($this->config->interactive === false
                && ($toScreen === false
                || (($this->reporter->totalErrors + $this->reporter->totalWarnings) === 0 && $this->config->showProgress === true))
            ) {
                Timing::printRunTime();
            }
        } catch (DeepExitException $e) {
            echo $e->getMessage();
            return $e->getCode();
        }//end try

        if ($numErrors === 0) {
            // No errors found.
            return 0;
        } else if ($this->reporter->totalFixable === 0) {
            // Errors found, but none of them can be fixed by PHPCBF.
            return 1;
        } else {
            // Errors found, and some can be fixed by PHPCBF.
            return 2;
        }

    }//end runPHPCS()


    /**
     * Run the PHPCBF script.
     *
     * @return int
     */
    public function runPHPCBF()
    {
        $this->registerOutOfMemoryShutdownMessage('phpcbf');

        if (defined('PHP_CODESNIFFER_CBF') === false) {
            define('PHP_CODESNIFFER_CBF', true);
        }

        try {
            Timing::startTiming();
            Runner::checkRequirements();

            // Creating the Config object populates it with all required settings
            // based on the CLI arguments provided to the script and any config
            // values the user has set.
            $this->config = new Config();

            // When processing STDIN, we can't output anything to the screen
            // or it will end up mixed in with the file output.
            if ($this->config->stdin === true) {
                $this->config->verbosity = 0;
            }

            // Init the run and load the rulesets to set additional config vars.
            $this->init();

            // When processing STDIN, we only process one file at a time and
            // we don't process all the way through, so we can't use the parallel
            // running system.
            if ($this->config->stdin === true) {
                $this->config->parallel = 1;
            }

            // Override some of the command line settings that might break the fixes.
            $this->config->generator    = null;
            $this->config->explain      = false;
            $this->config->interactive  = false;
            $this->config->cache        = false;
            $this->config->showSources  = false;
            $this->config->recordErrors = false;
            $this->config->reportFile   = null;

            // Only use the "Cbf" report, but allow for the Performance report as well.
            $originalReports = array_change_key_case($this->config->reports, CASE_LOWER);
            $newReports      = ['cbf' => null];
            if (array_key_exists('performance', $originalReports) === true) {
                $newReports['performance'] = $originalReports['performance'];
            }

            $this->config->reports = $newReports;

            // If a standard tries to set command line arguments itself, some
            // may be blocked because PHPCBF is running, so stop the script
            // dying if any are found.
            $this->config->dieOnUnknownArg = false;

            $this->run();
            $this->reporter->printReports();

            echo PHP_EOL;
            Timing::printRunTime();
        } catch (DeepExitException $e) {
            echo $e->getMessage();
            return $e->getCode();
        }//end try

        if ($this->reporter->totalFixed === 0) {
            // Nothing was fixed by PHPCBF.
            if ($this->reporter->totalFixable === 0) {
                // Nothing found that could be fixed.
                return 0;
            } else {
                // Something failed to fix.
                return 2;
            }
        }

        if ($this->reporter->totalFixable === 0) {
            // PHPCBF fixed all fixable errors.
            return 1;
        }

        // PHPCBF fixed some fixable errors, but others failed to fix.
        return 2;

    }//end runPHPCBF()


    /**
     * Exits if the minimum requirements of PHP_CodeSniffer are not met.
     *
     * @return void
     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException If the requirements are not met.
     */
    public function checkRequirements()
    {
        // Check the PHP version.
        if (PHP_VERSION_ID < 50400) {
            $error = 'ERROR: PHP_CodeSniffer requires PHP version 5.4.0 or greater.'.PHP_EOL;
            throw new DeepExitException($error, 3);
        }

        $requiredExtensions = [
            'tokenizer',
            'xmlwriter',
            'SimpleXML',
        ];
        $missingExtensions  = [];

        foreach ($requiredExtensions as $extension) {
            if (extension_loaded($extension) === false) {
                $missingExtensions[] = $extension;
            }
        }

        if (empty($missingExtensions) === false) {
            $last      = array_pop($requiredExtensions);
            $required  = implode(', ', $requiredExtensions);
            $required .= ' and '.$last;

            if (count($missingExtensions) === 1) {
                $missing = $missingExtensions[0];
            } else {
                $last     = array_pop($missingExtensions);
                $missing  = implode(', ', $missingExtensions);
                $missing .= ' and '.$last;
            }

            $error = 'ERROR: PHP_CodeSniffer requires the %s extensions to be enabled. Please enable %s.'.PHP_EOL;
            $error = sprintf($error, $required, $missing);
            throw new DeepExitException($error, 3);
        }

    }//end checkRequirements()


    /**
     * Init the rulesets and other high-level settings.
     *
     * @return void
     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException If a referenced standard is not installed.
     */
    public function init()
    {
        if (defined('PHP_CODESNIFFER_CBF') === false) {
            define('PHP_CODESNIFFER_CBF', false);
        }

        // Ensure this option is enabled or else line endings will not always
        // be detected properly for files created on a Mac with the /r line ending.
        @ini_set('auto_detect_line_endings', true);

        // Disable the PCRE JIT as this caused issues with parallel running.
        ini_set('pcre.jit', false);

        // Check that the standards are valid.
        foreach ($this->config->standards as $standard) {
            if (Standards::isInstalledStandard($standard) === false) {
                // They didn't select a valid coding standard, so help them
                // out by letting them know which standards are installed.
                $error = 'ERROR: the "'.$standard.'" coding standard is not installed. ';
                ob_start();
                Standards::printInstalledStandards();
                $error .= ob_get_contents();
                ob_end_clean();
                throw new DeepExitException($error, 3);
            }
        }

        // Saves passing the Config object into other objects that only need
        // the verbosity flag for debug output.
        if (defined('PHP_CODESNIFFER_VERBOSITY') === false) {
            define('PHP_CODESNIFFER_VERBOSITY', $this->config->verbosity);
        }

        // Create this class so it is autoloaded and sets up a bunch
        // of PHP_CodeSniffer-specific token type constants.
        new Tokens();

        // Allow autoloading of custom files inside installed standards.
        $installedStandards = Standards::getInstalledStandardDetails();
        foreach ($installedStandards as $details) {
            Autoload::addSearchPath($details['path'], $details['namespace']);
        }

        // The ruleset contains all the information about how the files
        // should be checked and/or fixed.
        try {
            $this->ruleset = new Ruleset($this->config);

            if ($this->ruleset->hasSniffDeprecations() === true) {
                $this->ruleset->showSniffDeprecations();
            }
        } catch (RuntimeException $e) {
            $error  = rtrim($e->getMessage(), "\r\n").PHP_EOL.PHP_EOL;
            $error .= $this->config->printShortUsage(true);
            throw new DeepExitException($error, 3);
        }

    }//end init()


    /**
     * Performs the run.
     *
     * @return int The number of errors and warnings found.
     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException
     * @throws \PHP_CodeSniffer\Exceptions\RuntimeException
     */
    private function run()
    {
        // The class that manages all reporters for the run.
        $this->reporter = new Reporter($this->config);

        // Include bootstrap files.
        foreach ($this->config->bootstrap as $bootstrap) {
            include $bootstrap;
        }

        if ($this->config->stdin === true) {
            $fileContents = $this->config->stdinContent;
            if ($fileContents === null) {
                $handle = fopen('php://stdin', 'r');
                stream_set_blocking($handle, true);
                $fileContents = stream_get_contents($handle);
                fclose($handle);
            }

            $todo  = new FileList($this->config, $this->ruleset);
            $dummy = new DummyFile($fileContents, $this->ruleset, $this->config);
            $todo->addFile($dummy->path, $dummy);
        } else {
            if (empty($this->config->files) === true) {
                $error  = 'ERROR: You must supply at least one file or directory to process.'.PHP_EOL.PHP_EOL;
                $error .= $this->config->printShortUsage(true);
                throw new DeepExitException($error, 3);
            }

            if (PHP_CODESNIFFER_VERBOSITY > 0) {
                echo 'Creating file list... ';
            }

            $todo = new FileList($this->config, $this->ruleset);

            if (PHP_CODESNIFFER_VERBOSITY > 0) {
                $numFiles = count($todo);
                echo "DONE ($numFiles files in queue)".PHP_EOL;
            }

            if ($this->config->cache === true) {
                if (PHP_CODESNIFFER_VERBOSITY > 0) {
                    echo 'Loading cache... ';
                }

                Cache::load($this->ruleset, $this->config);

                if (PHP_CODESNIFFER_VERBOSITY > 0) {
                    $size = Cache::getSize();
                    echo "DONE ($size files in cache)".PHP_EOL;
                }
            }
        }//end if

        // Turn all sniff errors into exceptions.
        set_error_handler([$this, 'handleErrors']);

        // If verbosity is too high, turn off parallelism so the
        // debug output is clean.
        if (PHP_CODESNIFFER_VERBOSITY > 1) {
            $this->config->parallel = 1;
        }

        // If the PCNTL extension isn't installed, we can't fork.
        if (function_exists('pcntl_fork') === false) {
            $this->config->parallel = 1;
        }

        $lastDir  = '';
        $numFiles = count($todo);

        if ($this->config->parallel === 1) {
            // Running normally.
            $numProcessed = 0;
            foreach ($todo as $path => $file) {
                if ($file->ignored === false) {
                    $currDir = dirname($path);
                    if ($lastDir !== $currDir) {
                        if (PHP_CODESNIFFER_VERBOSITY > 0) {
                            echo 'Changing into directory '.Common::stripBasepath($currDir, $this->config->basepath).PHP_EOL;
                        }

                        $lastDir = $currDir;
                    }

                    $this->processFile($file);
                } else if (PHP_CODESNIFFER_VERBOSITY > 0) {
                    echo 'Skipping '.basename($file->path).PHP_EOL;
                }

                $numProcessed++;
                $this->printProgress($file, $numFiles, $numProcessed);
            }
        } else {
            // Batching and forking.
            $childProcs  = [];
            $numPerBatch = ceil($numFiles / $this->config->parallel);

            for ($batch = 0; $batch < $this->config->parallel; $batch++) {
                $startAt = ($batch * $numPerBatch);
                if ($startAt >= $numFiles) {
                    break;
                }

                $endAt = ($startAt + $numPerBatch);
                if ($endAt > $numFiles) {
                    $endAt = $numFiles;
                }

                $childOutFilename = tempnam(sys_get_temp_dir(), 'phpcs-child');
                $pid = pcntl_fork();
                if ($pid === -1) {
                    throw new RuntimeException('Failed to create child process');
                } else if ($pid !== 0) {
                    $childProcs[$pid] = $childOutFilename;
                } else {
                    // Move forward to the start of the batch.
                    $todo->rewind();
                    for ($i = 0; $i < $startAt; $i++) {
                        $todo->next();
                    }

                    // Reset the reporter to make sure only figures from this
                    // file batch are recorded.
                    $this->reporter->totalFiles    = 0;
                    $this->reporter->totalErrors   = 0;
                    $this->reporter->totalWarnings = 0;
                    $this->reporter->totalFixable  = 0;
                    $this->reporter->totalFixed    = 0;

                    // Process the files.
                    $pathsProcessed = [];
                    ob_start();
                    for ($i = $startAt; $i < $endAt; $i++) {
                        $path = $todo->key();
                        $file = $todo->current();

                        if ($file->ignored === true) {
                            $todo->next();
                            continue;
                        }

                        $currDir = dirname($path);
                        if ($lastDir !== $currDir) {
                            if (PHP_CODESNIFFER_VERBOSITY > 0) {
                                echo 'Changing into directory '.Common::stripBasepath($currDir, $this->config->basepath).PHP_EOL;
                            }

                            $lastDir = $currDir;
                        }

                        $this->processFile($file);

                        $pathsProcessed[] = $path;
                        $todo->next();
                    }//end for

                    $debugOutput = ob_get_contents();
                    ob_end_clean();

                    // Write information about the run to the filesystem
                    // so it can be picked up by the main process.
                    $childOutput = [
                        'totalFiles'    => $this->reporter->totalFiles,
                        'totalErrors'   => $this->reporter->totalErrors,
                        'totalWarnings' => $this->reporter->totalWarnings,
                        'totalFixable'  => $this->reporter->totalFixable,
                        'totalFixed'    => $this->reporter->totalFixed,
                    ];

                    $output  = '<'.'?php'."\n".' $childOutput = ';
                    $output .= var_export($childOutput, true);
                    $output .= ";\n\$debugOutput = ";
                    $output .= var_export($debugOutput, true);

                    if ($this->config->cache === true) {
                        $childCache = [];
                        foreach ($pathsProcessed as $path) {
                            $childCache[$path] = Cache::get($path);
                        }

                        $output .= ";\n\$childCache = ";
                        $output .= var_export($childCache, true);
                    }

                    $output .= ";\n?".'>';
                    file_put_contents($childOutFilename, $output);
                    exit();
                }//end if
            }//end for

            $success = $this->processChildProcs($childProcs);
            if ($success === false) {
                throw new RuntimeException('One or more child processes failed to run');
            }
        }//end if

        restore_error_handler();

        if (PHP_CODESNIFFER_VERBOSITY === 0
            && $this->config->interactive === false
            && $this->config->showProgress === true
        ) {
            echo PHP_EOL.PHP_EOL;
        }

        if ($this->config->cache === true) {
            Cache::save();
        }

        $ignoreWarnings = Config::getConfigData('ignore_warnings_on_exit');
        $ignoreErrors   = Config::getConfigData('ignore_errors_on_exit');

        $return = ($this->reporter->totalErrors + $this->reporter->totalWarnings);
        if ($ignoreErrors !== null) {
            $ignoreErrors = (bool) $ignoreErrors;
            if ($ignoreErrors === true) {
                $return -= $this->reporter->totalErrors;
            }
        }

        if ($ignoreWarnings !== null) {
            $ignoreWarnings = (bool) $ignoreWarnings;
            if ($ignoreWarnings === true) {
                $return -= $this->reporter->totalWarnings;
            }
        }

        return $return;

    }//end run()


    /**
     * Converts all PHP errors into exceptions.
     *
     * This method forces a sniff to stop processing if it is not
     * able to handle a specific piece of code, instead of continuing
     * and potentially getting into a loop.
     *
     * @param int    $code    The level of error raised.
     * @param string $message The error message.
     * @param string $file    The path of the file that raised the error.
     * @param int    $line    The line number the error was raised at.
     *
     * @return bool
     * @throws \PHP_CodeSniffer\Exceptions\RuntimeException
     */
    public function handleErrors($code, $message, $file, $line)
    {
        if ((error_reporting() & $code) === 0) {
            // This type of error is being muted.
            return true;
        }

        throw new RuntimeException("$message in $file on line $line");

    }//end handleErrors()


    /**
     * Processes a single file, including checking and fixing.
     *
     * @param \PHP_CodeSniffer\Files\File $file The file to be processed.
     *
     * @return void
     * @throws \PHP_CodeSniffer\Exceptions\DeepExitException
     */
    public function processFile($file)
    {
        if (PHP_CODESNIFFER_VERBOSITY > 0) {
            $startTime = microtime(true);
            echo 'Processing '.basename($file->path).' ';
            if (PHP_CODESNIFFER_VERBOSITY > 1) {
                echo PHP_EOL;
            }
        }

        try {
            $file->process();

            if (PHP_CODESNIFFER_VERBOSITY > 0) {
                $timeTaken = ((microtime(true) - $startTime) * 1000);
                if ($timeTaken < 1000) {
                    $timeTaken = round($timeTaken);
                    echo "DONE in {$timeTaken}ms";
                } else {
                    $timeTaken = round(($timeTaken / 1000), 2);
                    echo "DONE in $timeTaken secs";
                }

                if (PHP_CODESNIFFER_CBF === true) {
                    $errors = $file->getFixableCount();
                    echo " ($errors fixable violations)".PHP_EOL;
                } else {
                    $errors   = $file->getErrorCount();
                    $warnings = $file->getWarningCount();
                    echo " ($errors errors, $warnings warnings)".PHP_EOL;
                }
            }
        } catch (Exception $e) {
            $error = 'An error occurred during processing; checking has been aborted. The error message was: '.$e->getMessage();

            // Determine which sniff caused the error.
            $sniffStack = null;
            $nextStack  = null;
            foreach ($e->getTrace() as $step) {
                if (isset($step['file']) === false) {
                    continue;
                }

                if (empty($sniffStack) === false) {
                    $nextStack = $step;
                    break;
                }

                if (substr($step['file'], -9) === 'Sniff.php') {
                    $sniffStack = $step;
                    continue;
                }
            }

            if (empty($sniffStack) === false) {
                $sniffCode = '';
                try {
                    if (empty($nextStack) === false
                        && isset($nextStack['class']) === true
                        && substr($nextStack['class'], -5) === 'Sniff'
                    ) {
                        $sniffCode = 'the '.Common::getSniffCode($nextStack['class']).' sniff';
                    }
                } catch (InvalidArgumentException $e) {
                    // Sniff code could not be determined. This may be an abstract sniff class.
                }

                if ($sniffCode === '') {
                    $sniffCode = substr(strrchr(str_replace('\\', '/', $sniffStack['file']), '/'), 1);
                }

                $error .= sprintf(PHP_EOL.'The error originated in %s on line %s.', $sniffCode, $sniffStack['line']);
            }

            $file->addErrorOnLine($error, 1, 'Internal.Exception');
        }//end try

        $this->reporter->cacheFileReport($file);

        if ($this->config->interactive === true) {
            /*
                Running interactively.
                Print the error report for the current file and then wait for user input.
            */

            // Get current violations and then clear the list to make sure
            // we only print violations for a single file each time.
            $numErrors = null;
            while ($numErrors !== 0) {
                $numErrors = ($file->getErrorCount() + $file->getWarningCount());
                if ($numErrors === 0) {
                    continue;
                }

                $this->reporter->printReport('full');

                echo '<ENTER> to recheck, [s] to skip or [q] to quit : ';
                $input = fgets(STDIN);
                $input = trim($input);

                switch ($input) {
                case 's':
                    break(2);
                case 'q':
                    throw new DeepExitException('', 0);
                default:
                    // Repopulate the sniffs because some of them save their state
                    // and only clear it when the file changes, but we are rechecking
                    // the same file.
                    $file->ruleset->populateTokenListeners();
                    $file->reloadContent();
                    $file->process();
                    $this->reporter->cacheFileReport($file);
                    break;
                }
            }//end while
        }//end if

        // Clean up the file to save (a lot of) memory.
        $file->cleanUp();

    }//end processFile()


    /**
     * Waits for child processes to complete and cleans up after them.
     *
     * The reporting information returned by each child process is merged
     * into the main reporter class.
     *
     * @param array<int, string> $childProcs An array of child processes to wait for.
     *
     * @return bool
     */
    private function processChildProcs($childProcs)
    {
        $numProcessed = 0;
        $totalBatches = count($childProcs);

        $success = true;

        while (count($childProcs) > 0) {
            $pid = pcntl_waitpid(0, $status);
            if ($pid <= 0 || isset($childProcs[$pid]) === false) {
                // No child or a child with an unmanaged PID was returned.
                continue;
            }

            $childProcessStatus = pcntl_wexitstatus($status);
            if ($childProcessStatus !== 0) {
                $success = false;
            }

            $out = $childProcs[$pid];
            unset($childProcs[$pid]);
            if (file_exists($out) === false) {
                continue;
            }

            include $out;
            unlink($out);

            $numProcessed++;

            if (isset($childOutput) === false) {
                // The child process died, so the run has failed.
                $file = new DummyFile('', $this->ruleset, $this->config);
                $file->setErrorCounts(1, 0, 0, 0);
                $this->printProgress($file, $totalBatches, $numProcessed);
                $success = false;
                continue;
            }

            $this->reporter->totalFiles    += $childOutput['totalFiles'];
            $this->reporter->totalErrors   += $childOutput['totalErrors'];
            $this->reporter->totalWarnings += $childOutput['totalWarnings'];
            $this->reporter->totalFixable  += $childOutput['totalFixable'];
            $this->reporter->totalFixed    += $childOutput['totalFixed'];

            if (isset($debugOutput) === true) {
                echo $debugOutput;
            }

            if (isset($childCache) === true) {
                foreach ($childCache as $path => $cache) {
                    Cache::set($path, $cache);
                }
            }

            // Fake a processed file so we can print progress output for the batch.
            $file = new DummyFile('', $this->ruleset, $this->config);
            $file->setErrorCounts(
                $childOutput['totalErrors'],
                $childOutput['totalWarnings'],
                $childOutput['totalFixable'],
                $childOutput['totalFixed']
            );
            $this->printProgress($file, $totalBatches, $numProcessed);
        }//end while

        return $success;

    }//end processChildProcs()


    /**
     * Print progress information for a single processed file.
     *
     * @param \PHP_CodeSniffer\Files\File $file         The file that was processed.
     * @param int                         $numFiles     The total number of files to process.
     * @param int                         $numProcessed The number of files that have been processed,
     *                                                  including this one.
     *
     * @return void
     */
    public function printProgress(File $file, $numFiles, $numProcessed)
    {
        if (PHP_CODESNIFFER_VERBOSITY > 0
            || $this->config->showProgress === false
        ) {
            return;
        }

        $showColors  = $this->config->colors;
        $colorOpen   = '';
        $progressDot = '.';
        $colorClose  = '';

        // Show progress information.
        if ($file->ignored === true) {
            $progressDot = 'S';
        } else {
            $errors   = $file->getErrorCount();
            $warnings = $file->getWarningCount();
            $fixable  = $file->getFixableCount();
            $fixed    = $file->getFixedCount();

            if (PHP_CODESNIFFER_CBF === true) {
                // Files with fixed errors or warnings are F (green).
                // Files with unfixable errors or warnings are E (red).
                // Files with no errors or warnings are . (black).
                if ($fixable > 0) {
                    $progressDot = 'E';

                    if ($showColors === true) {
                        $colorOpen  = "\033[31m";
                        $colorClose = "\033[0m";
                    }
                } else if ($fixed > 0) {
                    $progressDot = 'F';

                    if ($showColors === true) {
                        $colorOpen  = "\033[32m";
                        $colorClose = "\033[0m";
                    }
                }//end if
            } else {
                // Files with errors are E (red).
                // Files with fixable errors are E (green).
                // Files with warnings are W (yellow).
                // Files with fixable warnings are W (green).
                // Files with no errors or warnings are . (black).
                if ($errors > 0) {
                    $progressDot = 'E';

                    if ($showColors === true) {
                        if ($fixable > 0) {
                            $colorOpen = "\033[32m";
                        } else {
                            $colorOpen = "\033[31m";
                        }

                        $colorClose = "\033[0m";
                    }
                } else if ($warnings > 0) {
                    $progressDot = 'W';

                    if ($showColors === true) {
                        if ($fixable > 0) {
                            $colorOpen = "\033[32m";
                        } else {
                            $colorOpen = "\033[33m";
                        }

                        $colorClose = "\033[0m";
                    }
                }//end if
            }//end if
        }//end if

        echo $colorOpen.$progressDot.$colorClose;

        $numPerLine = 60;
        if ($numProcessed !== $numFiles && ($numProcessed % $numPerLine) !== 0) {
            return;
        }

        $percent = round(($numProcessed / $numFiles) * 100);
        $padding = (strlen($numFiles) - strlen($numProcessed));
        if ($numProcessed === $numFiles
            && $numFiles > $numPerLine
            && ($numProcessed % $numPerLine) !== 0
        ) {
            $padding += ($numPerLine - ($numFiles - (floor($numFiles / $numPerLine) * $numPerLine)));
        }

        echo str_repeat(' ', $padding)." $numProcessed / $numFiles ($percent%)".PHP_EOL;

    }//end printProgress()


    /**
     * Registers a PHP shutdown function to provide a more informative out of memory error.
     *
     * @param string $command The command which was used to initiate the PHPCS run.
     *
     * @return void
     */
    private function registerOutOfMemoryShutdownMessage($command)
    {
        // Allocate all needed memory beforehand as much as possible.
        $errorMsg    = PHP_EOL.'The PHP_CodeSniffer "%1$s" command ran out of memory.'.PHP_EOL;
        $errorMsg   .= 'Either raise the "memory_limit" of PHP in the php.ini file or raise the memory limit at runtime'.PHP_EOL;
        $errorMsg   .= 'using `%1$s -d memory_limit=512M` (replace 512M with the desired memory limit).'.PHP_EOL;
        $errorMsg    = sprintf($errorMsg, $command);
        $memoryError = 'Allowed memory size of';
        $errorArray  = [
            'type'    => 42,
            'message' => 'Some random dummy string to take up memory and take up some more memory and some more',
            'file'    => 'Another random string, which would be a filename this time. Should be relatively long to allow for deeply nested files',
            'line'    => 31427,
        ];

        register_shutdown_function(
            static function () use (
                $errorMsg,
                $memoryError,
                $errorArray
            ) {
                $errorArray = error_get_last();
                if (is_array($errorArray) === true && strpos($errorArray['message'], $memoryError) !== false) {
                    echo $errorMsg;
                }
            }
        );

    }//end registerOutOfMemoryShutdownMessage()


}//end class